C13H18O2 — CID 64738417
(3,4-dimethylcyclohexyl)-(furan-2-yl)methanone (PubChem CID 64738417) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (3,4-dimethylcyclohexyl)-(furan-2-yl)methanone.
| Compound Name | (3,4-dimethylcyclohexyl)-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 64738417 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (3,4-dimethylcyclohexyl)-(furan-2-yl)methanone |
| SMILES | CC1CCC(C(=O)c2ccco2)CC1C |
| InChI | InChI=1S/C13H18O2/c1-9-5-6-11(8-10(9)2)13(14)12-4-3-7-15-12/h3-4,7,9-11H,5-6,8H2,1-2H3 |
| InChIKey | GSNNOLPFLWIIMG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |