C10H10O3 — CID 43138918
1-cyclopropyl-3-(furan-2-yl)propane-1,3-dione (PubChem CID 43138918) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is 1-cyclopropyl-3-(furan-2-yl)propane-1,3-dione.
| Compound Name | 1-cyclopropyl-3-(furan-2-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 43138918 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 1-cyclopropyl-3-(furan-2-yl)propane-1,3-dione |
| SMILES | O=C(CC(=O)C1CC1)c1ccco1 |
| InChI | InChI=1S/C10H10O3/c11-8(7-3-4-7)6-9(12)10-2-1-5-13-10/h1-2,5,7H,3-4,6H2 |
| InChIKey | QDRVWJATRDKDFD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|