C10H11FO3 — CID 90929550
4-fluoro-1-(furan-2-yl)-4-methylpentane-1,3-dione (PubChem CID 90929550) has the molecular formula C10H11FO3 and a molecular weight of 198.19 g/mol. Its IUPAC name is 4-fluoro-1-(furan-2-yl)-4-methylpentane-1,3-dione.
| Compound Name | 4-fluoro-1-(furan-2-yl)-4-methylpentane-1,3-dione |
|---|---|
| PubChem CID | 90929550 |
| Molecular Formula | C10H11FO3 |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 4-fluoro-1-(furan-2-yl)-4-methylpentane-1,3-dione |
| SMILES | CC(C)(F)C(=O)CC(=O)c1ccco1 |
| InChI | InChI=1S/C10H11FO3/c1-10(2,11)9(13)6-7(12)8-4-3-5-14-8/h3-5H,6H2,1-2H3 |
| InChIKey | JQVYIKMYPBLSMH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|