C10H14O3 — CID 145463409
ethane;1-(furan-2-yl)butane-1,3-dione (PubChem CID 145463409) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is ethane;1-(furan-2-yl)butane-1,3-dione.
| Compound Name | ethane;1-(furan-2-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 145463409 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | ethane;1-(furan-2-yl)butane-1,3-dione |
| SMILES | CC.CC(=O)CC(=O)c1ccco1 |
| InChI | InChI=1S/C8H8O3.C2H6/c1-6(9)5-7(10)8-3-2-4-11-8;1-2/h2-4H,5H2,1H3;1-2H3 |
| InChIKey | XBUHMFZRSYNTSK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|