C13H21NO5 — CID 144767506
aminomethyl 4-(furan-2-yl)-2,4-dioxobutanoate;ethane (PubChem CID 144767506) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is aminomethyl 4-(furan-2-yl)-2,4-dioxobutanoate;ethane.
| Compound Name | aminomethyl 4-(furan-2-yl)-2,4-dioxobutanoate;ethane |
|---|---|
| PubChem CID | 144767506 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | aminomethyl 4-(furan-2-yl)-2,4-dioxobutanoate;ethane |
| SMILES | CC.CC.NCOC(=O)C(=O)CC(=O)c1ccco1 |
| InChI | InChI=1S/C9H9NO5.2C2H6/c10-5-15-9(13)7(12)4-6(11)8-2-1-3-14-8;2*1-2/h1-3H,4-5,10H2;2*1-2H3 |
| InChIKey | LVNAZDRBMDMOBD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|