C8H10CaO3 — CID 173386868
calcium;1-(furan-2-yl)butane-1,3-dione;hydride (PubChem CID 173386868) has the molecular formula C8H10CaO3 and a molecular weight of 194.24 g/mol. Its IUPAC name is calcium;1-(furan-2-yl)butane-1,3-dione;hydride.
| Compound Name | calcium;1-(furan-2-yl)butane-1,3-dione;hydride |
|---|---|
| PubChem CID | 173386868 |
| Molecular Formula | C8H10CaO3 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | calcium;1-(furan-2-yl)butane-1,3-dione;hydride |
| SMILES | CC(=O)CC(=O)c1ccco1.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C8H8O3.Ca.2H/c1-6(9)5-7(10)8-3-2-4-11-8;;;/h2-4H,5H2,1H3;;;/q;+2;2*-1 |
| InChIKey | RLAANAGNZCBOLP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|