About sodium;ethyl 3-(furan-2-yl)-3-oxopropanoate;hydride
sodium;ethyl 3-(furan-2-yl)-3-oxopropanoate;hydride (PubChem CID 175451832) has the molecular formula C9H11NaO4
and a molecular weight of 206.17 g/mol. Its IUPAC name is sodium;ethyl 3-(furan-2-yl)-3-oxopropanoate;hydride.
Molecular Properties
| Compound Name | sodium;ethyl 3-(furan-2-yl)-3-oxopropanoate;hydride |
| PubChem CID | 175451832 |
| Molecular Formula | C9H11NaO4 |
| Molecular Weight | 206.17 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | sodium;ethyl 3-(furan-2-yl)-3-oxopropanoate;hydride |
| SMILES | CCOC(=O)CC(=O)c1ccco1.[H-].[Na+] |
| InChI | InChI=1S/C9H10O4.Na.H/c1-2-12-9(11)6-7(10)8-4-3-5-13-8;;/h3-5H,2,6H2,1H3;;/q;+1;-1 |
| InChIKey | JYJKRHJMICVVPH-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.17 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze sodium;ethyl 3-(furan-2-yl)-3-oxopropanoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;ethyl 3-(furan-2-yl)-3-oxopropanoate;hydride?
The IUPAC name of sodium;ethyl 3-(furan-2-yl)-3-oxopropanoate;hydride (CID 175451832) is sodium;ethyl 3-(furan-2-yl)-3-oxopropanoate;hydride.
What is the SMILES notation for sodium;ethyl 3-(furan-2-yl)-3-oxopropanoate;hydride?
The canonical SMILES for sodium;ethyl 3-(furan-2-yl)-3-oxopropanoate;hydride is CCOC(=O)CC(=O)c1ccco1.[H-].[Na+].
What is the InChIKey of sodium;ethyl 3-(furan-2-yl)-3-oxopropanoate;hydride?
The InChIKey is JYJKRHJMICVVPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4.Na.H/c1-2-12-9(11)6-7(10)8-4-3-5-13-8;;/h3-5H,2,6H2,1H3;;/q;+1;-1.
What are the key properties of sodium;ethyl 3-(furan-2-yl)-3-oxopropanoate;hydride?
sodium;ethyl 3-(furan-2-yl)-3-oxopropanoate;hydride has a molecular weight of 206.17 g/mol, XLogP of -1.47, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;ethyl 3-(furan-2-yl)-3-oxopropanoate;hydride is sourced from PubChem (CID 175451832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).