C8H6F3NO2 — CID 170314111
4,4,4-trifluoro-1-(furan-2-yl)-3-iminobutan-1-one (PubChem CID 170314111) has the molecular formula C8H6F3NO2 and a molecular weight of 205.14 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-(furan-2-yl)-3-iminobutan-1-one.
| Compound Name | 4,4,4-trifluoro-1-(furan-2-yl)-3-iminobutan-1-one |
|---|---|
| PubChem CID | 170314111 |
| Molecular Formula | C8H6F3NO2 |
| Molecular Weight | 205.14 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 4,4,4-trifluoro-1-(furan-2-yl)-3-iminobutan-1-one |
| SMILES | [H]/N=C(/CC(=O)c1ccco1)C(F)(F)F |
| InChI | InChI=1S/C8H6F3NO2/c9-8(10,11)7(12)4-5(13)6-2-1-3-14-6/h1-3,12H,4H2/b12-7- |
| InChIKey | XANSERWPEXJSAG-GHXNOFRVSA-N |
| XLogP | 2.43 |
| TPSA | 54.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.14 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|