C7H4F3NO4 — CID 141040971
(furan-2-carbonylamino) 2,2,2-trifluoroacetate (PubChem CID 141040971) has the molecular formula C7H4F3NO4 and a molecular weight of 223.11 g/mol. Its IUPAC name is (furan-2-carbonylamino) 2,2,2-trifluoroacetate.
| Compound Name | (furan-2-carbonylamino) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 141040971 |
| Molecular Formula | C7H4F3NO4 |
| Molecular Weight | 223.11 g/mol |
| Exact Mass | 223.01 |
| IUPAC Name | (furan-2-carbonylamino) 2,2,2-trifluoroacetate |
| SMILES | O=C(NOC(=O)C(F)(F)F)c1ccco1 |
| InChI | InChI=1S/C7H4F3NO4/c8-7(9,10)6(13)15-11-5(12)4-2-1-3-14-4/h1-3H,(H,11,12) |
| InChIKey | KLAPRBLOGFJBGH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.11 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|