C9H11F2NO2 — CID 126790408
N-(3,3-difluorobutan-2-yl)furan-2-carboxamide (PubChem CID 126790408) has the molecular formula C9H11F2NO2 and a molecular weight of 203.19 g/mol. Its IUPAC name is N-(3,3-difluorobutan-2-yl)furan-2-carboxamide.
| Compound Name | N-(3,3-difluorobutan-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 126790408 |
| Molecular Formula | C9H11F2NO2 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | N-(3,3-difluorobutan-2-yl)furan-2-carboxamide |
| SMILES | CC(NC(=O)c1ccco1)C(C)(F)F |
| InChI | InChI=1S/C9H11F2NO2/c1-6(9(2,10)11)12-8(13)7-4-3-5-14-7/h3-6H,1-2H3,(H,12,13) |
| InChIKey | GJPBMODLGXFBGN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |