C9H8F3NO5 — CID 3751835
methyl 3,3,3-trifluoro-2-(furan-2-carbonylamino)-2-hydroxypropanoate (PubChem CID 3751835) has the molecular formula C9H8F3NO5 and a molecular weight of 267.16 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-(furan-2-carbonylamino)-2-hydroxypropanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-(furan-2-carbonylamino)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 3751835 |
| Molecular Formula | C9H8F3NO5 |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-(furan-2-carbonylamino)-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)(NC(=O)c1ccco1)C(F)(F)F |
| InChI | InChI=1S/C9H8F3NO5/c1-17-7(15)8(16,9(10,11)12)13-6(14)5-3-2-4-18-5/h2-4,16H,1H3,(H,13,14) |
| InChIKey | INVLDUQKLFUXBX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|