C15H16F3N2O5+ — CID 7035232
[(2S)-3-ethoxy-1,1,1-trifluoro-2-(furan-2-carbonylamino)-3-oxopropan-2-yl]-(furan-2-ylmethyl)azanium (PubChem CID 7035232) has the molecular formula C15H16F3N2O5+ and a molecular weight of 361.30 g/mol. Its IUPAC name is [(2S)-3-ethoxy-1,1,1-trifluoro-2-(furan-2-carbonylamino)-3-oxopropan-2-yl]-(furan-2-ylmethyl)azanium.
| Compound Name | [(2S)-3-ethoxy-1,1,1-trifluoro-2-(furan-2-carbonylamino)-3-oxopropan-2-yl]-(furan-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 7035232 |
| Molecular Formula | C15H16F3N2O5+ |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | [(2S)-3-ethoxy-1,1,1-trifluoro-2-(furan-2-carbonylamino)-3-oxopropan-2-yl]-(furan-2-ylmethyl)azanium |
| SMILES | CCOC(=O)[C@](NC(=O)c1ccco1)([NH2+]Cc1ccco1)C(F)(F)F |
| InChI | InChI=1S/C15H15F3N2O5/c1-2-23-13(22)14(15(16,17)18,19-9-10-5-3-7-24-10)20-12(21)11-6-4-8-25-11/h3-8,19H,2,9H2,1H3,(H,20,21)/p+1/t14-/m1/s1 |
| InChIKey | QUDZNXFBDSBETK-CQSZACIVSA-O |
| XLogP | 1.19 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|