C16H16F3N3O4 — CID 29093375
ethyl (2S)-3,3,3-trifluoro-2-(furan-2-carbonylamino)-2-[(3-methyl-2-pyridinyl)amino]propanoate (PubChem CID 29093375) has the molecular formula C16H16F3N3O4 and a molecular weight of 371.32 g/mol. Its IUPAC name is ethyl (2S)-3,3,3-trifluoro-2-(furan-2-carbonylamino)-2-[(3-methyl-2-pyridinyl)amino]propanoate.
| Compound Name | ethyl (2S)-3,3,3-trifluoro-2-(furan-2-carbonylamino)-2-[(3-methyl-2-pyridinyl)amino]propanoate |
|---|---|
| PubChem CID | 29093375 |
| Molecular Formula | C16H16F3N3O4 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | ethyl (2S)-3,3,3-trifluoro-2-(furan-2-carbonylamino)-2-[(3-methyl-2-pyridinyl)amino]propanoate |
| SMILES | CCOC(=O)[C@@](NC(=O)c1ccco1)(Nc1ncccc1C)C(F)(F)F |
| InChI | InChI=1S/C16H16F3N3O4/c1-3-25-14(24)15(16(17,18)19,21-12-10(2)6-4-8-20-12)22-13(23)11-7-5-9-26-11/h4-9H,3H2,1-2H3,(H,20,21)(H,22,23)/t15-/m0/s1 |
| InChIKey | TUWWHEHFGAQBBN-HNNXBMFYSA-N |
| XLogP | 2.65 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|