C19H20F3N3O4 — CID 7125083
ethyl (2R)-3,3,3-trifluoro-2-[(4-methoxybenzoyl)amino]-2-[(3-methyl-2-pyridinyl)amino]propanoate (PubChem CID 7125083) has the molecular formula C19H20F3N3O4 and a molecular weight of 411.38 g/mol. Its IUPAC name is ethyl (2R)-3,3,3-trifluoro-2-[(4-methoxybenzoyl)amino]-2-[(3-methyl-2-pyridinyl)amino]propanoate.
| Compound Name | ethyl (2R)-3,3,3-trifluoro-2-[(4-methoxybenzoyl)amino]-2-[(3-methyl-2-pyridinyl)amino]propanoate |
|---|---|
| PubChem CID | 7125083 |
| Molecular Formula | C19H20F3N3O4 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | ethyl (2R)-3,3,3-trifluoro-2-[(4-methoxybenzoyl)amino]-2-[(3-methyl-2-pyridinyl)amino]propanoate |
| SMILES | CCOC(=O)[C@](NC(=O)c1ccc(OC)cc1)(Nc1ncccc1C)C(F)(F)F |
| InChI | InChI=1S/C19H20F3N3O4/c1-4-29-17(27)18(19(20,21)22,24-15-12(2)6-5-11-23-15)25-16(26)13-7-9-14(28-3)10-8-13/h5-11H,4H2,1-3H3,(H,23,24)(H,25,26)/t18-/m1/s1 |
| InChIKey | NGSKFKOAXUDVKO-GOSISDBHSA-N |
| XLogP | 3.06 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|