C17H17F3N4O3 — CID 40596188
ethyl (2S)-3,3,3-trifluoro-2-[(2-phenylacetyl)amino]-2-(pyrimidin-2-ylamino)propanoate (PubChem CID 40596188) has the molecular formula C17H17F3N4O3 and a molecular weight of 382.34 g/mol. Its IUPAC name is ethyl (2S)-3,3,3-trifluoro-2-[(2-phenylacetyl)amino]-2-(pyrimidin-2-ylamino)propanoate.
| Compound Name | ethyl (2S)-3,3,3-trifluoro-2-[(2-phenylacetyl)amino]-2-(pyrimidin-2-ylamino)propanoate |
|---|---|
| PubChem CID | 40596188 |
| Molecular Formula | C17H17F3N4O3 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | ethyl (2S)-3,3,3-trifluoro-2-[(2-phenylacetyl)amino]-2-(pyrimidin-2-ylamino)propanoate |
| SMILES | CCOC(=O)[C@@](NC(=O)Cc1ccccc1)(Nc1ncccn1)C(F)(F)F |
| InChI | InChI=1S/C17H17F3N4O3/c1-2-27-14(26)16(17(18,19)20,24-15-21-9-6-10-22-15)23-13(25)11-12-7-4-3-5-8-12/h3-10H,2,11H2,1H3,(H,23,25)(H,21,22,24)/t16-/m1/s1 |
| InChIKey | COMLSVMXMUQJGL-MRXNPFEDSA-N |
| XLogP | 2.07 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|