C19H18F4N2O3 — CID 56696656
ethyl 2-(benzylamino)-3,3,3-trifluoro-2-[(4-fluorobenzoyl)amino]propanoate (PubChem CID 56696656) has the molecular formula C19H18F4N2O3 and a molecular weight of 398.36 g/mol. Its IUPAC name is ethyl 2-(benzylamino)-3,3,3-trifluoro-2-[(4-fluorobenzoyl)amino]propanoate.
| Compound Name | ethyl 2-(benzylamino)-3,3,3-trifluoro-2-[(4-fluorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 56696656 |
| Molecular Formula | C19H18F4N2O3 |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | ethyl 2-(benzylamino)-3,3,3-trifluoro-2-[(4-fluorobenzoyl)amino]propanoate |
| SMILES | CCOC(=O)C(NCc1ccccc1)(NC(=O)c1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C19H18F4N2O3/c1-2-28-17(27)18(19(21,22)23,24-12-13-6-4-3-5-7-13)25-16(26)14-8-10-15(20)11-9-14/h3-11,24H,2,12H2,1H3,(H,25,26) |
| InChIKey | KXGLFBICDZFLOL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|