C14H13F4N5O3 — CID 3581473
ethyl 3,3,3-trifluoro-2-[(4-fluorobenzoyl)amino]-2-(1,2,4-triazol-4-ylamino)propanoate (PubChem CID 3581473) has the molecular formula C14H13F4N5O3 and a molecular weight of 375.28 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-[(4-fluorobenzoyl)amino]-2-(1,2,4-triazol-4-ylamino)propanoate.
| Compound Name | ethyl 3,3,3-trifluoro-2-[(4-fluorobenzoyl)amino]-2-(1,2,4-triazol-4-ylamino)propanoate |
|---|---|
| PubChem CID | 3581473 |
| Molecular Formula | C14H13F4N5O3 |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-[(4-fluorobenzoyl)amino]-2-(1,2,4-triazol-4-ylamino)propanoate |
| SMILES | CCOC(=O)C(NC(=O)c1ccc(F)cc1)(Nn1cnnc1)C(F)(F)F |
| InChI | InChI=1S/C14H13F4N5O3/c1-2-26-12(25)13(14(16,17)18,22-23-7-19-20-8-23)21-11(24)9-3-5-10(15)6-4-9/h3-8,22H,2H2,1H3,(H,21,24) |
| InChIKey | KOAWHMIANRUDSN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|