C14H12F3N3O4 — CID 3580849
methyl 3,3,3-trifluoro-2-(furan-2-carbonylamino)-2-(pyridin-2-ylamino)propanoate (PubChem CID 3580849) has the molecular formula C14H12F3N3O4 and a molecular weight of 343.26 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-(furan-2-carbonylamino)-2-(pyridin-2-ylamino)propanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-(furan-2-carbonylamino)-2-(pyridin-2-ylamino)propanoate |
|---|---|
| PubChem CID | 3580849 |
| Molecular Formula | C14H12F3N3O4 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-(furan-2-carbonylamino)-2-(pyridin-2-ylamino)propanoate |
| SMILES | COC(=O)C(NC(=O)c1ccco1)(Nc1ccccn1)C(F)(F)F |
| InChI | InChI=1S/C14H12F3N3O4/c1-23-12(22)13(14(15,16)17,19-10-6-2-3-7-18-10)20-11(21)9-5-4-8-24-9/h2-8H,1H3,(H,18,19)(H,20,21) |
| InChIKey | BHVLUMLAQJLSLL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|