C11H14N2O3 — CID 115174756
methyl 2,2-dimethyl-3-oxo-3-(pyridin-2-ylamino)propanoate (PubChem CID 115174756) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-oxo-3-(pyridin-2-ylamino)propanoate.
| Compound Name | methyl 2,2-dimethyl-3-oxo-3-(pyridin-2-ylamino)propanoate |
|---|---|
| PubChem CID | 115174756 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | methyl 2,2-dimethyl-3-oxo-3-(pyridin-2-ylamino)propanoate |
| SMILES | COC(=O)C(C)(C)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C11H14N2O3/c1-11(2,10(15)16-3)9(14)13-8-6-4-5-7-12-8/h4-7H,1-3H3,(H,12,13,14) |
| InChIKey | AICBSRKLEOLMEG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|