methyl 2,2-dimethyl-3-oxo-3-(pyridin-4-ylamino)propanoate

C11H14N2O3 — CID 115174758

IUPACmethyl 2,2-dimethyl-3-oxo-3-(pyridin-4-ylamino)propanoate
SMILESCOC(=O)C(C)(C)C(=O)Nc1ccncc1
InChIInChI=1S/C11H14N2O3/c1-11(2,10(15)16-3)9(14)13-8-4-6-12-7-5-8/h4-7H,1-3H3,(H,12,13,14)
InChIKeyFRTBUTWWKKEWQZ-UHFFFAOYSA-N
MW222.24 g/mol
LogP1.22
Rot. Bonds3

About methyl 2,2-dimethyl-3-oxo-3-(pyridin-4-ylamino)propanoate

methyl 2,2-dimethyl-3-oxo-3-(pyridin-4-ylamino)propanoate (PubChem CID 115174758) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-oxo-3-(pyridin-4-ylamino)propanoate.

Molecular Properties

Compound Namemethyl 2,2-dimethyl-3-oxo-3-(pyridin-4-ylamino)propanoate
PubChem CID115174758
Molecular FormulaC11H14N2O3
Molecular Weight222.24 g/mol
Exact Mass222.10
IUPAC Namemethyl 2,2-dimethyl-3-oxo-3-(pyridin-4-ylamino)propanoate
SMILESCOC(=O)C(C)(C)C(=O)Nc1ccncc1
InChIInChI=1S/C11H14N2O3/c1-11(2,10(15)16-3)9(14)13-8-4-6-12-7-5-8/h4-7H,1-3H3,(H,12,13,14)
InChIKeyFRTBUTWWKKEWQZ-UHFFFAOYSA-N
XLogP1.22
TPSA68.29 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.24
LogP ≤ 51.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze methyl 2,2-dimethyl-3-oxo-3-(pyridin-4-ylamino)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,2-dimethyl-3-oxo-3-(pyridin-4-ylamino)propanoate?
The IUPAC name of methyl 2,2-dimethyl-3-oxo-3-(pyridin-4-ylamino)propanoate (CID 115174758) is methyl 2,2-dimethyl-3-oxo-3-(pyridin-4-ylamino)propanoate.
What is the SMILES notation for methyl 2,2-dimethyl-3-oxo-3-(pyridin-4-ylamino)propanoate?
The canonical SMILES for methyl 2,2-dimethyl-3-oxo-3-(pyridin-4-ylamino)propanoate is COC(=O)C(C)(C)C(=O)Nc1ccncc1.
What is the InChIKey of methyl 2,2-dimethyl-3-oxo-3-(pyridin-4-ylamino)propanoate?
The InChIKey is FRTBUTWWKKEWQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O3/c1-11(2,10(15)16-3)9(14)13-8-4-6-12-7-5-8/h4-7H,1-3H3,(H,12,13,14).
What are the key properties of methyl 2,2-dimethyl-3-oxo-3-(pyridin-4-ylamino)propanoate?
methyl 2,2-dimethyl-3-oxo-3-(pyridin-4-ylamino)propanoate has a molecular weight of 222.24 g/mol, XLogP of 1.22, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2-dimethyl-3-oxo-3-(pyridin-4-ylamino)propanoate is sourced from PubChem (CID 115174758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).