C23H33NO5 — CID 59310790
methyl (Z)-5-(3-anilino-2,2-dimethyl-3-oxopropanoyl)oxy-2,2,3,4,5-pentamethylhex-3-enoate (PubChem CID 59310790) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is methyl (Z)-5-(3-anilino-2,2-dimethyl-3-oxopropanoyl)oxy-2,2,3,4,5-pentamethylhex-3-enoate.
| Compound Name | methyl (Z)-5-(3-anilino-2,2-dimethyl-3-oxopropanoyl)oxy-2,2,3,4,5-pentamethylhex-3-enoate |
|---|---|
| PubChem CID | 59310790 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | methyl (Z)-5-(3-anilino-2,2-dimethyl-3-oxopropanoyl)oxy-2,2,3,4,5-pentamethylhex-3-enoate |
| SMILES | COC(=O)C(C)(C)/C(C)=C(/C)C(C)(C)OC(=O)C(C)(C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H33NO5/c1-15(21(3,4)19(26)28-9)16(2)23(7,8)29-20(27)22(5,6)18(25)24-17-13-11-10-12-14-17/h10-14H,1-9H3,(H,24,25)/b16-15- |
| InChIKey | JXKULKMTNSGSBO-NXVVXOECSA-N |
| XLogP | 4.51 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|