C24H34O5 — CID 58482698
methyl (Z)-5-(2,2-dimethyl-3-oxo-4-phenylbutanoyl)oxy-2,2,3,4,5-pentamethylhex-3-enoate (PubChem CID 58482698) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is methyl (Z)-5-(2,2-dimethyl-3-oxo-4-phenylbutanoyl)oxy-2,2,3,4,5-pentamethylhex-3-enoate.
| Compound Name | methyl (Z)-5-(2,2-dimethyl-3-oxo-4-phenylbutanoyl)oxy-2,2,3,4,5-pentamethylhex-3-enoate |
|---|---|
| PubChem CID | 58482698 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | methyl (Z)-5-(2,2-dimethyl-3-oxo-4-phenylbutanoyl)oxy-2,2,3,4,5-pentamethylhex-3-enoate |
| SMILES | COC(=O)C(C)(C)/C(C)=C(/C)C(C)(C)OC(=O)C(C)(C)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C24H34O5/c1-16(22(3,4)20(26)28-9)17(2)24(7,8)29-21(27)23(5,6)19(25)15-18-13-11-10-12-14-18/h10-14H,15H2,1-9H3/b17-16- |
| InChIKey | RUDOGPZAWMDNDR-MSUUIHNZSA-N |
| XLogP | 4.68 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|