C11H14N2O3 — CID 90850690
N'-hydroxy-2,2-dimethyl-N-phenylpropanediamide (PubChem CID 90850690) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-N-phenylpropanediamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-N-phenylpropanediamide |
|---|---|
| PubChem CID | 90850690 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-N-phenylpropanediamide |
| SMILES | CC(C)(C(=O)NO)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C11H14N2O3/c1-11(2,10(15)13-16)9(14)12-8-6-4-3-5-7-8/h3-7,16H,1-2H3,(H,12,14)(H,13,15) |
| InChIKey | BXPZTDIBWFTVDG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|