C17H17FN2O2 — CID 108967144
N'-(2-fluorophenyl)-2,2-dimethyl-N-phenylpropanediamide (PubChem CID 108967144) has the molecular formula C17H17FN2O2 and a molecular weight of 300.33 g/mol. Its IUPAC name is N'-(2-fluorophenyl)-2,2-dimethyl-N-phenylpropanediamide.
| Compound Name | N'-(2-fluorophenyl)-2,2-dimethyl-N-phenylpropanediamide |
|---|---|
| PubChem CID | 108967144 |
| Molecular Formula | C17H17FN2O2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N'-(2-fluorophenyl)-2,2-dimethyl-N-phenylpropanediamide |
| SMILES | CC(C)(C(=O)Nc1ccccc1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C17H17FN2O2/c1-17(2,15(21)19-12-8-4-3-5-9-12)16(22)20-14-11-7-6-10-13(14)18/h3-11H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | DWTXCNHAGXUKTR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|