C21H24F2N2O2 — CID 108968655
N-(2-tert-butylphenyl)-N'-(3,4-difluorophenyl)-2,2-dimethylpropanediamide (PubChem CID 108968655) has the molecular formula C21H24F2N2O2 and a molecular weight of 374.43 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-N'-(3,4-difluorophenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-(2-tert-butylphenyl)-N'-(3,4-difluorophenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108968655 |
| Molecular Formula | C21H24F2N2O2 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N-(2-tert-butylphenyl)-N'-(3,4-difluorophenyl)-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)Nc1ccc(F)c(F)c1)C(=O)Nc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C21H24F2N2O2/c1-20(2,3)14-8-6-7-9-17(14)25-19(27)21(4,5)18(26)24-13-10-11-15(22)16(23)12-13/h6-12H,1-5H3,(H,24,26)(H,25,27) |
| InChIKey | PTFLDZZLQXTJGL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|