C18H10F10N2O2 — CID 4123319
2,2,3,3,4,4,5,5-octafluoro-N,N'-bis(2-fluorophenyl)hexanediamide (PubChem CID 4123319) has the molecular formula C18H10F10N2O2 and a molecular weight of 476.27 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-N,N'-bis(2-fluorophenyl)hexanediamide.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-N,N'-bis(2-fluorophenyl)hexanediamide |
|---|---|
| PubChem CID | 4123319 |
| Molecular Formula | C18H10F10N2O2 |
| Molecular Weight | 476.27 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-N,N'-bis(2-fluorophenyl)hexanediamide |
| SMILES | O=C(Nc1ccccc1F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C18H10F10N2O2/c19-9-5-1-3-7-11(9)29-13(31)15(21,22)17(25,26)18(27,28)16(23,24)14(32)30-12-8-4-2-6-10(12)20/h1-8H,(H,29,31)(H,30,32) |
| InChIKey | MPWFKGPAAAXYAM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.27 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|