C14H5F14NO2S — CID 91721170
S-[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl] 2,2,3,3,4,4,4-heptafluorobutanethioate (PubChem CID 91721170) has the molecular formula C14H5F14NO2S and a molecular weight of 517.24 g/mol. Its IUPAC name is S-[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl] 2,2,3,3,4,4,4-heptafluorobutanethioate.
| Compound Name | S-[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl] 2,2,3,3,4,4,4-heptafluorobutanethioate |
|---|---|
| PubChem CID | 91721170 |
| Molecular Formula | C14H5F14NO2S |
| Molecular Weight | 517.24 g/mol |
| Exact Mass | 516.98 |
| IUPAC Name | S-[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)phenyl] 2,2,3,3,4,4,4-heptafluorobutanethioate |
| SMILES | O=C(Nc1ccccc1SC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H5F14NO2S/c15-9(16,11(19,20)13(23,24)25)7(30)29-5-3-1-2-4-6(5)32-8(31)10(17,18)12(21,22)14(26,27)28/h1-4H,(H,29,30) |
| InChIKey | IYPCMRZEADVPHK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.24 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|