C19H15F7N2O2 — CID 177391846
2,2,3,3,4,4,4-heptafluoro-N-[2-(3-phenylpropanoylamino)phenyl]butanamide (PubChem CID 177391846) has the molecular formula C19H15F7N2O2 and a molecular weight of 436.33 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-[2-(3-phenylpropanoylamino)phenyl]butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-[2-(3-phenylpropanoylamino)phenyl]butanamide |
|---|---|
| PubChem CID | 177391846 |
| Molecular Formula | C19H15F7N2O2 |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-[2-(3-phenylpropanoylamino)phenyl]butanamide |
| SMILES | O=C(CCc1ccccc1)Nc1ccccc1NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H15F7N2O2/c20-17(21,18(22,23)19(24,25)26)16(30)28-14-9-5-4-8-13(14)27-15(29)11-10-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,27,29)(H,28,30) |
| InChIKey | ORXFBLJODDXYIA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|