C16H15NO4 — CID 10334118
2-[3-(4-hydroxyphenyl)propanoylamino]benzoic acid (PubChem CID 10334118) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-[3-(4-hydroxyphenyl)propanoylamino]benzoic acid.
| Compound Name | 2-[3-(4-hydroxyphenyl)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 10334118 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-[3-(4-hydroxyphenyl)propanoylamino]benzoic acid |
| SMILES | O=C(CCc1ccc(O)cc1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C16H15NO4/c18-12-8-5-11(6-9-12)7-10-15(19)17-14-4-2-1-3-13(14)16(20)21/h1-6,8-9,18H,7,10H2,(H,17,19)(H,20,21) |
| InChIKey | DLFOKZQWYFNKCL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |