C23H21NO3 — CID 11523335
2-[3-[4-(2-methylphenyl)phenyl]propanoylamino]benzoic acid (PubChem CID 11523335) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[3-[4-(2-methylphenyl)phenyl]propanoylamino]benzoic acid.
| Compound Name | 2-[3-[4-(2-methylphenyl)phenyl]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 11523335 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-[3-[4-(2-methylphenyl)phenyl]propanoylamino]benzoic acid |
| SMILES | Cc1ccccc1-c1ccc(CCC(=O)Nc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C23H21NO3/c1-16-6-2-3-7-19(16)18-13-10-17(11-14-18)12-15-22(25)24-21-9-5-4-8-20(21)23(26)27/h2-11,13-14H,12,15H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | VKCIGBKESIDUAE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |