C24H34N2O9 — CID 175729912
(2R,3R,4R,5S)-6-(ethylamino)hexane-1,2,3,4,5-pentol;2-[3-(4-hydroxyphenyl)propanoylamino]benzoic acid (PubChem CID 175729912) has the molecular formula C24H34N2O9 and a molecular weight of 494.54 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-(ethylamino)hexane-1,2,3,4,5-pentol;2-[3-(4-hydroxyphenyl)propanoylamino]benzoic acid.
| Compound Name | (2R,3R,4R,5S)-6-(ethylamino)hexane-1,2,3,4,5-pentol;2-[3-(4-hydroxyphenyl)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 175729912 |
| Molecular Formula | C24H34N2O9 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | (2R,3R,4R,5S)-6-(ethylamino)hexane-1,2,3,4,5-pentol;2-[3-(4-hydroxyphenyl)propanoylamino]benzoic acid |
| SMILES | CCNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C(CCc1ccc(O)cc1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C16H15NO4.C8H19NO5/c18-12-8-5-11(6-9-12)7-10-15(19)17-14-4-2-1-3-13(14)16(20)21;1-2-9-3-5(11)7(13)8(14)6(12)4-10/h1-6,8-9,18H,7,10H2,(H,17,19)(H,20,21);5-14H,2-4H2,1H3/t;5-,6+,7+,8+/m.0/s1 |
| InChIKey | NAWHTHYJEMGPQM-HUDOLUFHSA-N |
| XLogP | -0.31 |
| TPSA | 199.81 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |