C26H21NO3 — CID 11552978
2-[3-(4-naphthalen-2-ylphenyl)propanoylamino]benzoic acid (PubChem CID 11552978) has the molecular formula C26H21NO3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-[3-(4-naphthalen-2-ylphenyl)propanoylamino]benzoic acid.
| Compound Name | 2-[3-(4-naphthalen-2-ylphenyl)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 11552978 |
| Molecular Formula | C26H21NO3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-[3-(4-naphthalen-2-ylphenyl)propanoylamino]benzoic acid |
| SMILES | O=C(CCc1ccc(-c2ccc3ccccc3c2)cc1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C26H21NO3/c28-25(27-24-8-4-3-7-23(24)26(29)30)16-11-18-9-12-20(13-10-18)22-15-14-19-5-1-2-6-21(19)17-22/h1-10,12-15,17H,11,16H2,(H,27,28)(H,29,30) |
| InChIKey | MJKIXPAGESUOIR-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |