C20H18N2O3S — CID 89378211
4-[3-[4-(3-aminophenyl)phenyl]propanoylamino]thiophene-3-carboxylic acid (PubChem CID 89378211) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is 4-[3-[4-(3-aminophenyl)phenyl]propanoylamino]thiophene-3-carboxylic acid.
| Compound Name | 4-[3-[4-(3-aminophenyl)phenyl]propanoylamino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 89378211 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 4-[3-[4-(3-aminophenyl)phenyl]propanoylamino]thiophene-3-carboxylic acid |
| SMILES | Nc1cccc(-c2ccc(CCC(=O)Nc3cscc3C(=O)O)cc2)c1 |
| InChI | InChI=1S/C20H18N2O3S/c21-16-3-1-2-15(10-16)14-7-4-13(5-8-14)6-9-19(23)22-18-12-26-11-17(18)20(24)25/h1-5,7-8,10-12H,6,9,21H2,(H,22,23)(H,24,25) |
| InChIKey | SVTYLLKBYVDDTO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|