C20H18N2O3 — CID 71767585
3-(4-naphthalen-2-ylbutanoylamino)pyridine-4-carboxylic acid (PubChem CID 71767585) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 3-(4-naphthalen-2-ylbutanoylamino)pyridine-4-carboxylic acid.
| Compound Name | 3-(4-naphthalen-2-ylbutanoylamino)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 71767585 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 3-(4-naphthalen-2-ylbutanoylamino)pyridine-4-carboxylic acid |
| SMILES | O=C(CCCc1ccc2ccccc2c1)Nc1cnccc1C(=O)O |
| InChI | InChI=1S/C20H18N2O3/c23-19(22-18-13-21-11-10-17(18)20(24)25)7-3-4-14-8-9-15-5-1-2-6-16(15)12-14/h1-2,5-6,8-13H,3-4,7H2,(H,22,23)(H,24,25) |
| InChIKey | NXHRRUHTFZFIGL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |