C20H19NO3S — CID 24765200
3-(5-naphthalen-2-ylpentanoylamino)thiophene-2-carboxylic acid (PubChem CID 24765200) has the molecular formula C20H19NO3S and a molecular weight of 353.44 g/mol. Its IUPAC name is 3-(5-naphthalen-2-ylpentanoylamino)thiophene-2-carboxylic acid.
| Compound Name | 3-(5-naphthalen-2-ylpentanoylamino)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 24765200 |
| Molecular Formula | C20H19NO3S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 3-(5-naphthalen-2-ylpentanoylamino)thiophene-2-carboxylic acid |
| SMILES | O=C(CCCCc1ccc2ccccc2c1)Nc1ccsc1C(=O)O |
| InChI | InChI=1S/C20H19NO3S/c22-18(21-17-11-12-25-19(17)20(23)24)8-4-1-5-14-9-10-15-6-2-3-7-16(15)13-14/h2-3,6-7,9-13H,1,4-5,8H2,(H,21,22)(H,23,24) |
| InChIKey | DUGWOHCQJDUXFG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|