C20H19NO4S — CID 24765202
3-[5-(6-hydroxynaphthalen-2-yl)pentanoylamino]thiophene-2-carboxylic acid (PubChem CID 24765202) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is 3-[5-(6-hydroxynaphthalen-2-yl)pentanoylamino]thiophene-2-carboxylic acid.
| Compound Name | 3-[5-(6-hydroxynaphthalen-2-yl)pentanoylamino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 24765202 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 3-[5-(6-hydroxynaphthalen-2-yl)pentanoylamino]thiophene-2-carboxylic acid |
| SMILES | O=C(CCCCc1ccc2cc(O)ccc2c1)Nc1ccsc1C(=O)O |
| InChI | InChI=1S/C20H19NO4S/c22-16-8-7-14-11-13(5-6-15(14)12-16)3-1-2-4-18(23)21-17-9-10-26-19(17)20(24)25/h5-12,22H,1-4H2,(H,21,23)(H,24,25) |
| InChIKey | IKABNMGIGJQMBS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|