C11H12N2O4S2 — CID 43358194
3-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]thiophene-2-carboxylic acid (PubChem CID 43358194) has the molecular formula C11H12N2O4S2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]thiophene-2-carboxylic acid.
| Compound Name | 3-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43358194 |
| Molecular Formula | C11H12N2O4S2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 3-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]thiophene-2-carboxylic acid |
| SMILES | O=C(CCN1CCSC1=O)Nc1ccsc1C(=O)O |
| InChI | InChI=1S/C11H12N2O4S2/c14-8(1-3-13-4-6-19-11(13)17)12-7-2-5-18-9(7)10(15)16/h2,5H,1,3-4,6H2,(H,12,14)(H,15,16) |
| InChIKey | SVOUBHADAGBPSK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|