C13H14N2O5S — CID 61406074
5-hydroxy-2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]benzoic acid (PubChem CID 61406074) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is 5-hydroxy-2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]benzoic acid.
| Compound Name | 5-hydroxy-2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 61406074 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 5-hydroxy-2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]benzoic acid |
| SMILES | O=C(CCN1CCSC1=O)Nc1ccc(O)cc1C(=O)O |
| InChI | InChI=1S/C13H14N2O5S/c16-8-1-2-10(9(7-8)12(18)19)14-11(17)3-4-15-5-6-21-13(15)20/h1-2,7,16H,3-6H2,(H,14,17)(H,18,19) |
| InChIKey | HHTVJEMSJHZDPM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|