C15H16F3N3O3S — CID 46696387
N-[4-acetamido-2-(trifluoromethyl)phenyl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide (PubChem CID 46696387) has the molecular formula C15H16F3N3O3S and a molecular weight of 375.37 g/mol. Its IUPAC name is N-[4-acetamido-2-(trifluoromethyl)phenyl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide.
| Compound Name | N-[4-acetamido-2-(trifluoromethyl)phenyl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide |
|---|---|
| PubChem CID | 46696387 |
| Molecular Formula | C15H16F3N3O3S |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-[4-acetamido-2-(trifluoromethyl)phenyl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)CCN2CCSC2=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H16F3N3O3S/c1-9(22)19-10-2-3-12(11(8-10)15(16,17)18)20-13(23)4-5-21-6-7-25-14(21)24/h2-3,8H,4-7H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | HGQHVOYOHXJOFM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|