C20H10F14N2O2 — CID 91744876
2,2,3,3,4,4,4-heptafluoro-N-[2-[N-(2,2,3,3,4,4,4-heptafluorobutanoyl)anilino]phenyl]butanamide (PubChem CID 91744876) has the molecular formula C20H10F14N2O2 and a molecular weight of 576.28 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-[2-[N-(2,2,3,3,4,4,4-heptafluorobutanoyl)anilino]phenyl]butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-[2-[N-(2,2,3,3,4,4,4-heptafluorobutanoyl)anilino]phenyl]butanamide |
|---|---|
| PubChem CID | 91744876 |
| Molecular Formula | C20H10F14N2O2 |
| Molecular Weight | 576.28 g/mol |
| Exact Mass | 576.05 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-[2-[N-(2,2,3,3,4,4,4-heptafluorobutanoyl)anilino]phenyl]butanamide |
| SMILES | O=C(Nc1ccccc1N(C(=O)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H10F14N2O2/c21-15(22,17(25,26)19(29,30)31)13(37)35-11-8-4-5-9-12(11)36(10-6-2-1-3-7-10)14(38)16(23,24)18(27,28)20(32,33)34/h1-9H,(H,35,37) |
| InChIKey | CSTBRJHVTBOTBH-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.28 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|