C15H5F18NO3 — CID 163045888
(2S)-2,3,3,3-tetrafluoro-N-(2-fluorophenyl)-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanamide (PubChem CID 163045888) has the molecular formula C15H5F18NO3 and a molecular weight of 589.17 g/mol. Its IUPAC name is (2S)-2,3,3,3-tetrafluoro-N-(2-fluorophenyl)-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanamide.
| Compound Name | (2S)-2,3,3,3-tetrafluoro-N-(2-fluorophenyl)-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanamide |
|---|---|
| PubChem CID | 163045888 |
| Molecular Formula | C15H5F18NO3 |
| Molecular Weight | 589.17 g/mol |
| Exact Mass | 589.00 |
| IUPAC Name | (2S)-2,3,3,3-tetrafluoro-N-(2-fluorophenyl)-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanamide |
| SMILES | O=C(Nc1ccccc1F)[C@@](F)(OC(F)(F)[C@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H5F18NO3/c16-5-3-1-2-4-6(5)34-7(35)8(17,11(21,22)23)36-15(32,33)10(20,13(27,28)29)37-14(30,31)9(18,19)12(24,25)26/h1-4H,(H,34,35)/t8-,10-/m1/s1 |
| InChIKey | TWPSWNLVAUPOLK-PSASIEDQSA-N |
| XLogP | 6.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.17 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|