C18H10F11NO2 — CID 92904968
(2R)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-(2-phenylphenyl)propanamide (PubChem CID 92904968) has the molecular formula C18H10F11NO2 and a molecular weight of 481.26 g/mol. Its IUPAC name is (2R)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-(2-phenylphenyl)propanamide.
| Compound Name | (2R)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-(2-phenylphenyl)propanamide |
|---|---|
| PubChem CID | 92904968 |
| Molecular Formula | C18H10F11NO2 |
| Molecular Weight | 481.26 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | (2R)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-(2-phenylphenyl)propanamide |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)[C@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H10F11NO2/c19-14(16(22,23)24,32-18(28,29)15(20,21)17(25,26)27)13(31)30-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H,(H,30,31)/t14-/m0/s1 |
| InChIKey | WFBFZUHBSWNCJE-AWEZNQCLSA-N |
| XLogP | 6.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.26 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|