C12H8F11N3O6 — CID 163163342
1-N,3-N-dihydroxy-4-[[(2S)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl]amino]benzene-1,3-diamine oxide (PubChem CID 163163342) has the molecular formula C12H8F11N3O6 and a molecular weight of 499.19 g/mol. Its IUPAC name is 1-N,3-N-dihydroxy-4-[[(2S)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl]amino]benzene-1,3-diamine oxide.
| Compound Name | 1-N,3-N-dihydroxy-4-[[(2S)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl]amino]benzene-1,3-diamine oxide |
|---|---|
| PubChem CID | 163163342 |
| Molecular Formula | C12H8F11N3O6 |
| Molecular Weight | 499.19 g/mol |
| Exact Mass | 499.02 |
| IUPAC Name | 1-N,3-N-dihydroxy-4-[[(2S)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl]amino]benzene-1,3-diamine oxide |
| SMILES | O=C(Nc1ccc([NH+]([O-])O)cc1[NH+]([O-])O)[C@@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H8F11N3O6/c13-8(10(16,17)18,32-12(22,23)9(14,15)11(19,20)21)7(27)24-5-2-1-4(25(28)29)3-6(5)26(30)31/h1-3,25-26,28,30H,(H,24,27)/t8-/m1/s1 |
| InChIKey | RTPKKQABCCDJLI-MRVPVSSYSA-N |
| XLogP | 1.47 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|