C10H6Cl2F6N2O3 — CID 163154723
5-chloro-2-[[2-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]amino]-N-hydroxybenzeneamine oxide (PubChem CID 163154723) has the molecular formula C10H6Cl2F6N2O3 and a molecular weight of 387.06 g/mol. Its IUPAC name is 5-chloro-2-[[2-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]amino]-N-hydroxybenzeneamine oxide.
| Compound Name | 5-chloro-2-[[2-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]amino]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163154723 |
| Molecular Formula | C10H6Cl2F6N2O3 |
| Molecular Weight | 387.06 g/mol |
| Exact Mass | 385.97 |
| IUPAC Name | 5-chloro-2-[[2-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propanoyl]amino]-N-hydroxybenzeneamine oxide |
| SMILES | O=C(Nc1ccc(Cl)cc1[NH+]([O-])O)C(Cl)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H6Cl2F6N2O3/c11-4-1-2-5(6(3-4)20(22)23)19-7(21)8(12,9(13,14)15)10(16,17)18/h1-3,20,22H,(H,19,21) |
| InChIKey | OQUIXDNJHKMCFG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.06 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|