C8H5ClF3N2O3- — CID 163133531
N-[4-chloro-2-[hydroxy(oxido)amino]phenyl]-2,2,2-trifluoroacetamide (PubChem CID 163133531) has the molecular formula C8H5ClF3N2O3- and a molecular weight of 269.59 g/mol. Its IUPAC name is N-[4-chloro-2-[hydroxy(oxido)amino]phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-chloro-2-[hydroxy(oxido)amino]phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 163133531 |
| Molecular Formula | C8H5ClF3N2O3- |
| Molecular Weight | 269.59 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | N-[4-chloro-2-[hydroxy(oxido)amino]phenyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1ccc(Cl)cc1N([O-])O)C(F)(F)F |
| InChI | InChI=1S/C8H5ClF3N2O3/c9-4-1-2-5(6(3-4)14(16)17)13-7(15)8(10,11)12/h1-3,16H,(H,13,15)/q-1 |
| InChIKey | QWPLVLZXWRGKSI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.59 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|