C12H10ClF6N2O3- — CID 163183109
N-[4-chloro-2-[hydroxy(oxido)amino]phenyl]-2,2-bis(trifluoromethyl)butanamide (PubChem CID 163183109) has the molecular formula C12H10ClF6N2O3- and a molecular weight of 379.66 g/mol. Its IUPAC name is N-[4-chloro-2-[hydroxy(oxido)amino]phenyl]-2,2-bis(trifluoromethyl)butanamide.
| Compound Name | N-[4-chloro-2-[hydroxy(oxido)amino]phenyl]-2,2-bis(trifluoromethyl)butanamide |
|---|---|
| PubChem CID | 163183109 |
| Molecular Formula | C12H10ClF6N2O3- |
| Molecular Weight | 379.66 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | N-[4-chloro-2-[hydroxy(oxido)amino]phenyl]-2,2-bis(trifluoromethyl)butanamide |
| SMILES | CCC(C(=O)Nc1ccc(Cl)cc1N([O-])O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H10ClF6N2O3/c1-2-10(11(14,15)16,12(17,18)19)9(22)20-7-4-3-6(13)5-8(7)21(23)24/h3-5,23H,2H2,1H3,(H,20,22)/q-1 |
| InChIKey | DHTMCLLOTYUAQC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.66 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|