C11H9F6N3O5-2 — CID 163154528
N-[2-(dihydroxyamino)-4-(dioxidoamino)phenyl]-3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanamide (PubChem CID 163154528) has the molecular formula C11H9F6N3O5-2 and a molecular weight of 377.20 g/mol. Its IUPAC name is N-[2-(dihydroxyamino)-4-(dioxidoamino)phenyl]-3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanamide.
| Compound Name | N-[2-(dihydroxyamino)-4-(dioxidoamino)phenyl]-3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 163154528 |
| Molecular Formula | C11H9F6N3O5-2 |
| Molecular Weight | 377.20 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | N-[2-(dihydroxyamino)-4-(dioxidoamino)phenyl]-3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(N([O-])[O-])cc1N(O)O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H9F6N3O5/c1-9(10(12,13)14,11(15,16)17)8(21)18-6-3-2-5(19(22)23)4-7(6)20(24)25/h2-4,24-25H,1H3,(H,18,21)/q-2 |
| InChIKey | ZZELYTTWJXIIFG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.20 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|