C11H15N5O5-2 — CID 21157423
N-[2-(dihydroxyamino)-4-(dioxidoamino)anilino]-N'-(2-oxopropyl)ethanimidamide (PubChem CID 21157423) has the molecular formula C11H15N5O5-2 and a molecular weight of 297.27 g/mol. Its IUPAC name is N-[2-(dihydroxyamino)-4-(dioxidoamino)anilino]-N'-(2-oxopropyl)ethanimidamide.
| Compound Name | N-[2-(dihydroxyamino)-4-(dioxidoamino)anilino]-N'-(2-oxopropyl)ethanimidamide |
|---|---|
| PubChem CID | 21157423 |
| Molecular Formula | C11H15N5O5-2 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[2-(dihydroxyamino)-4-(dioxidoamino)anilino]-N'-(2-oxopropyl)ethanimidamide |
| SMILES | CC(=O)C/N=C(\C)NNc1ccc(N([O-])[O-])cc1N(O)O |
| InChI | InChI=1S/C11H15N5O5/c1-7(17)6-12-8(2)13-14-10-4-3-9(15(18)19)5-11(10)16(20)21/h3-5,14,20-21H,6H2,1-2H3,(H,12,13)/q-2 |
| InChIKey | JJANBBYPTDLHQP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 146.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|