C12H12F6N4O5-2 — CID 20834114
(4E)-4-[[2-(dihydroxyamino)-4-(dioxidoamino)phenyl]hydrazinylidene]-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-ol (PubChem CID 20834114) has the molecular formula C12H12F6N4O5-2 and a molecular weight of 406.24 g/mol. Its IUPAC name is (4E)-4-[[2-(dihydroxyamino)-4-(dioxidoamino)phenyl]hydrazinylidene]-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-ol.
| Compound Name | (4E)-4-[[2-(dihydroxyamino)-4-(dioxidoamino)phenyl]hydrazinylidene]-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-ol |
|---|---|
| PubChem CID | 20834114 |
| Molecular Formula | C12H12F6N4O5-2 |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | (4E)-4-[[2-(dihydroxyamino)-4-(dioxidoamino)phenyl]hydrazinylidene]-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-ol |
| SMILES | C/C(CC(O)(C(F)(F)F)C(F)(F)F)=N\Nc1ccc(N([O-])[O-])cc1N(O)O |
| InChI | InChI=1S/C12H12F6N4O5/c1-6(5-10(23,11(13,14)15)12(16,17)18)19-20-8-3-2-7(21(24)25)4-9(8)22(26)27/h2-4,20,23,26-27H,5H2,1H3/q-2/b19-6+ |
| InChIKey | MGAMROFMMREBNI-KPSZGOFPSA-N |
| XLogP | 3.11 |
| TPSA | 137.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|