C15H21F3N3O5P — CID 91970173
N-[(4-dimethoxyphosphoryl-4-methylpentan-2-ylidene)amino]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 91970173) has the molecular formula C15H21F3N3O5P and a molecular weight of 411.32 g/mol. Its IUPAC name is N-[(4-dimethoxyphosphoryl-4-methylpentan-2-ylidene)amino]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(4-dimethoxyphosphoryl-4-methylpentan-2-ylidene)amino]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 91970173 |
| Molecular Formula | C15H21F3N3O5P |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | N-[(4-dimethoxyphosphoryl-4-methylpentan-2-ylidene)amino]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | COP(=O)(OC)C(C)(C)CC(C)=NNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21F3N3O5P/c1-10(9-14(2,3)27(24,25-4)26-5)19-20-12-7-6-11(15(16,17)18)8-13(12)21(22)23/h6-8,20H,9H2,1-5H3 |
| InChIKey | JPQGCSPJMMSQLM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|